Rifampicin
| DRUG INFORMATION |
| Drug Name |
| Rifampicin |
 |
| Synonyms |
| Rifampin, Rifampicin, Rifadin, Ramp, Rifaldazine, Archidyn, Rimactane, Rifagen, Riforal, Rifa, Abrifam, Eremfat, Dipicin, 3-(((4-Methyl-1-piperazinyl)imino)-methyl)rifamycin, rifampicina, rifampicin quinone, Rimycin, Rifamicin AMP, Rifoldin, Rifamate, Rifobac, Rifater, Rifaprodin |
| Drug Class |
| First-Line Drugs |
| Year of Introduction |
| 1965 |
| Molecular Target |
| RNA Polymerase Rv0667 |
| Genes Involved in Drug Resistance |
| rpoB |
| CAS No: |
| 13292-46-1 |
| PHARMACOLOGY |
| Route |
| oral |
| Side effects |
| Frequent: orange discoloration of urine, tears, sweat. Occ: hepatitis (2.7% w/other TB rx)-cholestatic changes in first month; jaundice; GI intolerance; pruritis (6%); hypersensitivity rxn(in 0.07-0.3%), flu-like syndrome (0 (0.4-0.7%) when taking RIF 2x/wk |
| Toxicity |
| Low |
| Cost |
| Medium |
| Usual Adult Dosage |
| 600mg po or IV qd; DOT TB regimen: 10mg/kg (max 600mg) 2-3x/week (3x/week with multi-lobar involvement). Staph nasal carrier: 600mg bid x 2d. |
| Form |
| cap |
| Brand Name |
| Rifadin ,Rifamate ,Rifater |
| Manufacturer |
| Aventis Pharmaceuticals (HMR), P.O. Box 9627 / 10236 Marion Park Dr, Kansas City, MO, 64134-0627 ,(888) 242-9321 |
| STRUCTURAL DETAILS |
| Molecular Formula |
| C43H58N4O12 |
| Molecular Weight in g/mol |
| 822.94 |
| Hydrogen Bond Donor Count |
| 6 |
| Hydrogen Bond Acceptor Count |
| 15 |
| Rotatable Bond Count |
| 5 |
| IUPAC Name |
| (7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z)-2,15,17,27, 29-pentahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl- 26-{(E)-[(4-methylpiperazin-1-yl)imino]methyl}-6,23-dioxo-8, 30-dioxa-24-azatetracyclo[23.3.1.1~4,7~.0~5,28~]triaconta-1 (29),2,4,9,19,21,25,27-octaen-13-yl acetate |
| SMILES |
| C[C@H]1C=CC=C(C(=O)N=C2C(=CNN3CCN(CC3)C)C(=C4C(=C2O)C(=C(C5=C4C(=O)[C@](O5)(OC=C[C@@H]([C@H]([C@H]([C@@H]([C@@H]([C@@H]([C@H]1O)C)O)C)OC(=O)C)C)OC)C)C)O)O)C |
| InChI |
| 1/C43H58N4O12/c1-21-12-11-13-22(2)42(55)45-33-28(20-44-47-17-15-46(9)16-18-47)37(52)30-31(38(33)53)36(51)26(6)40-32(30)41(54)43(8,59-40)57-19-14-29(56-10)23(3)39(58-27(7)48)25(5)35(50)24(4)34(21)49/h11-14,19-21,23-25,29,34-35,39,44,49-53H,15-18H2, 1-10H3/t21-,23+,24+,25+,29-,34-,35+,39+,43-/m0/s1 |
New Search