Streptomycin
| DRUG INFORMATION |
| Drug Name |
| Streptomycin |
 |
| Synonyms |
| Streptomycin A Sulfate,Streptomycin sulfate (2:3) salt, Streptomycin sesquisulfate, Strycin, Streptobrettin, Vetstrep, Agrimycin 17, phytomycin, strepcin, streptomycin,Streptomycin sulfate,Streptomycin sulphate ,Streptomycin & EEP, Liposomal Streptomycin, Streptomycin & Propolis, Streptomycin & CRL8131, AIDS007346, AIDS088819, AIDS032286 |
| Drug Class |
| First-Line Drugs |
| Year of Introduction |
| 1944 |
| Molecular Target |
| Ribosomal Proteins Rv0682 |
| Genes Involved in Drug Resistance |
| rpoL,rrs,strA,S12 |
| CAS No: |
| 3810-74-0 |
| PHARMACOLOGY |
| Route |
| im |
| Side effects |
| Occasional: renal failure, oto/vestibular damage. Optic nerve dysfunction, peripheral neuritis, arachnoiditis, neuromuscular blockade, encephalopathy reported. The most ototoxic of all aminoglycosides. PEAK SHOULD NOT EXCEED 20-25 MCG/ML. |
| Toxicity |
| Medium |
| Cost |
| High |
| Usual Adult Dosage |
| 15mg/kg/d (max 1gm) IM qd. TB DOT regimen:25-30mg/kg 2-3x/wk. Enterococcal endocarditis (synergy with ampicillin if sensitive to streptomycin w/ <2000 mcg/ml): 7.5mg/kg IM q12h (max dose per day is 2gm)(target peak 1hour after IM dose is 20mcg/ml |
| Form |
| vial |
| Brand Name |
| Streptomycin |
| Manufacturer |
| X-GEN, Inc., P.O. Box 445, Big Flats, NY 14814, 1.866.390.4411, info@x-gen.us |
| STRUCTURAL DETAILS |
| Molecular Formula |
| C21H39N7O12 |
| Molecular Weight in g/mol |
| 581.574 |
| Hydrogen Bond Donor Count |
| 12 |
| Hydrogen Bond Acceptor Count |
| 19 |
| Rotatable Bond Count |
| 9 |
| IUPAC Name |
| 2-[4-[3-[4,5-dihydroxy-6-(hydroxymethyl)-3-methylamino-oxan-2-yl]oxy-4-formyl-4-hydroxy-5-methyl-oxolan-2-yl]oxy-3-guanidino-2,5,6-trihydroxy-cyclohexyl]guanidine |
| SMILES |
| C[C@H]1[C@@]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H]([C@@H]([C@H]2O)O)N=C(N)N)O)N=C(N)N)O[C@H]3[C@H]([C@@H]([C@H]([C@@H](O3)CO)O)O)NC)(C=O)O |
| InChI |
| 1/C21H39N7O12/c1-5-21(36,4-30)16(40-17-9(26-2)13(34)10(31)6(3-29)38-17)18(37-5)39-15-8(28-20(24)25)11(32)7(27-19(22)23)12(33)14(15)35/h4-18,26,29,31-36H,3H2,1-2H3,(H4,22,23,27)(H4,24,25,28)/t5-,6-,7+,8-,9-,10-,11+,12-,13-,14+,15+,16-,17-,18-, 21+/m0/s1/f/h22-25H2 |
New Search